C20H16ClN3O2S — CID 141355126
3-(4-chlorobutyl)-1-(4-cyanophenyl)sulfonylindole-5-carbonitrile (PubChem CID 141355126) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is 3-(4-chlorobutyl)-1-(4-cyanophenyl)sulfonylindole-5-carbonitrile.
| Compound Name | 3-(4-chlorobutyl)-1-(4-cyanophenyl)sulfonylindole-5-carbonitrile |
|---|---|
| PubChem CID | 141355126 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-(4-chlorobutyl)-1-(4-cyanophenyl)sulfonylindole-5-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cc(CCCCCl)c3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C20H16ClN3O2S/c21-10-2-1-3-17-14-24(20-9-6-16(13-23)11-19(17)20)27(25,26)18-7-4-15(12-22)5-8-18/h4-9,11,14H,1-3,10H2 |
| InChIKey | ITYCRNAKGZWNPX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|