C25H29IN2O4S — CID 122536974
3-(1,1-diethoxy-5-iodopentyl)-1-(4-methylphenyl)sulfonylindole-5-carbonitrile (PubChem CID 122536974) has the molecular formula C25H29IN2O4S and a molecular weight of 580.49 g/mol. Its IUPAC name is 3-(1,1-diethoxy-5-iodopentyl)-1-(4-methylphenyl)sulfonylindole-5-carbonitrile.
| Compound Name | 3-(1,1-diethoxy-5-iodopentyl)-1-(4-methylphenyl)sulfonylindole-5-carbonitrile |
|---|---|
| PubChem CID | 122536974 |
| Molecular Formula | C25H29IN2O4S |
| Molecular Weight | 580.49 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 3-(1,1-diethoxy-5-iodopentyl)-1-(4-methylphenyl)sulfonylindole-5-carbonitrile |
| SMILES | CCOC(CCCCI)(OCC)c1cn(S(=O)(=O)c2ccc(C)cc2)c2ccc(C#N)cc12 |
| InChI | InChI=1S/C25H29IN2O4S/c1-4-31-25(32-5-2,14-6-7-15-26)23-18-28(24-13-10-20(17-27)16-22(23)24)33(29,30)21-11-8-19(3)9-12-21/h8-13,16,18H,4-7,14-15H2,1-3H3 |
| InChIKey | PPCIMFMSRZNVQR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|