C21H13F3N2S2 — CID 142472342
1-(4-methylphenyl)sulfanyl-3-[2-(trifluoromethyl)thiophen-3-yl]indole-5-carbonitrile (PubChem CID 142472342) has the molecular formula C21H13F3N2S2 and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfanyl-3-[2-(trifluoromethyl)thiophen-3-yl]indole-5-carbonitrile.
| Compound Name | 1-(4-methylphenyl)sulfanyl-3-[2-(trifluoromethyl)thiophen-3-yl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 142472342 |
| Molecular Formula | C21H13F3N2S2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 1-(4-methylphenyl)sulfanyl-3-[2-(trifluoromethyl)thiophen-3-yl]indole-5-carbonitrile |
| SMILES | Cc1ccc(Sn2cc(-c3ccsc3C(F)(F)F)c3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C21H13F3N2S2/c1-13-2-5-15(6-3-13)28-26-12-18(16-8-9-27-20(16)21(22,23)24)17-10-14(11-25)4-7-19(17)26/h2-10,12H,1H3 |
| InChIKey | QODRHSXGQDVQHW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |