C18H26FNO5 — CID 142473576
2-[[2-(dimethoxymethyl)-5-fluoro-4-methylphenyl]methyl-(2,2-dimethylpropanoyl)amino]acetic acid (PubChem CID 142473576) has the molecular formula C18H26FNO5 and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[[2-(dimethoxymethyl)-5-fluoro-4-methylphenyl]methyl-(2,2-dimethylpropanoyl)amino]acetic acid.
| Compound Name | 2-[[2-(dimethoxymethyl)-5-fluoro-4-methylphenyl]methyl-(2,2-dimethylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 142473576 |
| Molecular Formula | C18H26FNO5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-[[2-(dimethoxymethyl)-5-fluoro-4-methylphenyl]methyl-(2,2-dimethylpropanoyl)amino]acetic acid |
| SMILES | COC(OC)c1cc(C)c(F)cc1CN(CC(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H26FNO5/c1-11-7-13(16(24-5)25-6)12(8-14(11)19)9-20(10-15(21)22)17(23)18(2,3)4/h7-8,16H,9-10H2,1-6H3,(H,21,22) |
| InChIKey | CAJONUZGWWYUMH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|