C16H17N3S — CID 14247363
2-butylsulfanyl-6-methyl-4-pyridin-4-ylpyridine-3-carbonitrile (PubChem CID 14247363) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-butylsulfanyl-6-methyl-4-pyridin-4-ylpyridine-3-carbonitrile.
| Compound Name | 2-butylsulfanyl-6-methyl-4-pyridin-4-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 14247363 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-butylsulfanyl-6-methyl-4-pyridin-4-ylpyridine-3-carbonitrile |
| SMILES | CCCCSc1nc(C)cc(-c2ccncc2)c1C#N |
| InChI | InChI=1S/C16H17N3S/c1-3-4-9-20-16-15(11-17)14(10-12(2)19-16)13-5-7-18-8-6-13/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | IJPCNFPYWIHLTK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|