About 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine
7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine (PubChem CID 142474983) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine.
Analyze 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine?
The IUPAC name of 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine (CID 142474983) is 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine.
What is the SMILES notation for 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine?
The canonical SMILES for 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine is CNC1=CCC(C)=CC=C1OC.
What is the InChIKey of 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine?
The InChIKey is JHBHPAXIUUBDRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-8-4-6-9(11-2)10(12-3)7-5-8/h5-7,11H,4H2,1-3H3.
What are the key properties of 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine?
7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine has a molecular weight of 165.24 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N,4-dimethylcyclohepta-1,4,6-trien-1-amine is sourced from PubChem (CID 142474983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).