About 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene
2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene (PubChem CID 142475789) has the molecular formula C29H34
and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene.
Molecular Properties
| Compound Name | 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene |
| PubChem CID | 142475789 |
| Molecular Formula | C29H34 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene |
| SMILES | Cc1ccc2cc(-c3ccc(C)c(C45CC(C)CC(CC(C)C4)C5)c3)ccc2c1 |
| InChI | InChI=1S/C29H34/c1-19-5-7-25-14-26(10-9-24(25)13-19)27-8-6-22(4)28(15-27)29-16-20(2)11-23(18-29)12-21(3)17-29/h5-10,13-15,20-21,23H,11-12,16-18H2,1-4H3 |
| InChIKey | IFWOKOSBSYCGMJ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene?
The IUPAC name of 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene (CID 142475789) is 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene.
What is the SMILES notation for 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene?
The canonical SMILES for 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene is Cc1ccc2cc(-c3ccc(C)c(C45CC(C)CC(CC(C)C4)C5)c3)ccc2c1.
What is the InChIKey of 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene?
The InChIKey is IFWOKOSBSYCGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34/c1-19-5-7-25-14-26(10-9-24(25)13-19)27-8-6-22(4)28(15-27)29-16-20(2)11-23(18-29)12-21(3)17-29/h5-10,13-15,20-21,23H,11-12,16-18H2,1-4H3.
What are the key properties of 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene?
2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene has a molecular weight of 382.59 g/mol, XLogP of 8.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-methylphenyl]-6-methylnaphthalene is sourced from PubChem (CID 142475789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).