C44H42N4 — CID 142477067
aniline;N-[1-[4-methyl-5-(8-methyl-14-azatricyclo[8.3.1.02,7]tetradeca-1(13),2,4,6,9,11-hexaen-9-yl)cyclohexa-1,5-dien-1-yl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide (PubChem CID 142477067) has the molecular formula C44H42N4 and a molecular weight of 626.85 g/mol. Its IUPAC name is aniline;N-[1-[4-methyl-5-(8-methyl-14-azatricyclo[8.3.1.02,7]tetradeca-1(13),2,4,6,9,11-hexaen-9-yl)cyclohexa-1,5-dien-1-yl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide.
| Compound Name | aniline;N-[1-[4-methyl-5-(8-methyl-14-azatricyclo[8.3.1.02,7]tetradeca-1(13),2,4,6,9,11-hexaen-9-yl)cyclohexa-1,5-dien-1-yl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142477067 |
| Molecular Formula | C44H42N4 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | aniline;N-[1-[4-methyl-5-(8-methyl-14-azatricyclo[8.3.1.02,7]tetradeca-1(13),2,4,6,9,11-hexaen-9-yl)cyclohexa-1,5-dien-1-yl]ethylidene]-N'-(1-phenylethenyl)benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\C)C1=CCC(C)C(C2=C3C=CC=C(N3)c3ccccc3C2C)=C1)c1ccccc1)c1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C38H35N3.C6H7N/c1-25-22-23-31(24-34(25)37-26(2)32-18-11-12-19-33(32)35-20-13-21-36(37)41-35)28(4)40-38(30-16-9-6-10-17-30)39-27(3)29-14-7-5-8-15-29;7-6-4-2-1-3-5-6/h5-21,23-26,41H,3,22H2,1-2,4H3;1-5H,7H2/b39-38+,40-28+; |
| InChIKey | MWBJTLQXZABZLL-IMNZLNOESA-N |
| XLogP | 10.30 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|