C23H26N4O3 — CID 142479642
3-[3-[4-[2-[5-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-3-yl]ethynyl]phenoxy]azetidin-1-yl]propan-1-ol (PubChem CID 142479642) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-[3-[4-[2-[5-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-3-yl]ethynyl]phenoxy]azetidin-1-yl]propan-1-ol.
| Compound Name | 3-[3-[4-[2-[5-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-3-yl]ethynyl]phenoxy]azetidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 142479642 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-[3-[4-[2-[5-[(2-ethylimidazol-1-yl)methyl]-1,2-oxazol-3-yl]ethynyl]phenoxy]azetidin-1-yl]propan-1-ol |
| SMILES | CCc1nccn1Cc1cc(C#Cc2ccc(OC3CN(CCCO)C3)cc2)no1 |
| InChI | InChI=1S/C23H26N4O3/c1-2-23-24-10-12-27(23)17-21-14-19(25-30-21)7-4-18-5-8-20(9-6-18)29-22-15-26(16-22)11-3-13-28/h5-6,8-10,12,14,22,28H,2-3,11,13,15-17H2,1H3 |
| InChIKey | VWDUSABDABNASM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|