C21H28BN5O7 — CID 142485472
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanediamide (PubChem CID 142485472) has the molecular formula C21H28BN5O7 and a molecular weight of 473.30 g/mol. Its IUPAC name is (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanediamide.
| Compound Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanediamide |
|---|---|
| PubChem CID | 142485472 |
| Molecular Formula | C21H28BN5O7 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-N-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]pentanediamide |
| SMILES | CCN1CCN(C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]2Cc3cccc(C)c3OB2O)C(=O)C1=O |
| InChI | InChI=1S/C21H28BN5O7/c1-3-26-9-10-27(20(31)19(26)30)21(32)24-14(7-8-16(23)28)18(29)25-15-11-13-6-4-5-12(2)17(13)34-22(15)33/h4-6,14-15,33H,3,7-11H2,1-2H3,(H2,23,28)(H,24,32)(H,25,29)/t14-,15+/m1/s1 |
| InChIKey | MRJJGXUHOGXVTN-CABCVRRESA-N |
| XLogP | -1.53 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|