C11H7N3O — CID 142486483
pyrimido[6,1-b]quinazolin-10-one (PubChem CID 142486483) has the molecular formula C11H7N3O and a molecular weight of 197.20 g/mol. Its IUPAC name is pyrimido[6,1-b]quinazolin-10-one.
| Compound Name | pyrimido[6,1-b]quinazolin-10-one |
|---|---|
| PubChem CID | 142486483 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | pyrimido[6,1-b]quinazolin-10-one |
| SMILES | O=c1c2ccccc2nc2ccncn12 |
| InChI | InChI=1S/C11H7N3O/c15-11-8-3-1-2-4-9(8)13-10-5-6-12-7-14(10)11/h1-7H |
| InChIKey | ODBJDGBPEHENEE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|