C27H29FO6 — CID 142488181
[(1S,2S,4S,5R,7S,8S,10S)-7-fluoro-5,16-dihydroxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadeca-13,16-dien-14-yl]-phenylmethanone (PubChem CID 142488181) has the molecular formula C27H29FO6 and a molecular weight of 468.52 g/mol. Its IUPAC name is [(1S,2S,4S,5R,7S,8S,10S)-7-fluoro-5,16-dihydroxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadeca-13,16-dien-14-yl]-phenylmethanone.
| Compound Name | [(1S,2S,4S,5R,7S,8S,10S)-7-fluoro-5,16-dihydroxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadeca-13,16-dien-14-yl]-phenylmethanone |
|---|---|
| PubChem CID | 142488181 |
| Molecular Formula | C27H29FO6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [(1S,2S,4S,5R,7S,8S,10S)-7-fluoro-5,16-dihydroxy-1-methyl-6-propan-2-yl-3,9,15-trioxahexacyclo[10.7.0.02,4.02,8.08,10.013,17]nonadeca-13,16-dien-14-yl]-phenylmethanone |
| SMILES | CC(C)C1[C@@H](O)[C@@H]2O[C@]23[C@]2(O[C@H]2CC2c4c(C(=O)c5ccccc5)oc(O)c4CC[C@@]23C)[C@H]1F |
| InChI | InChI=1S/C27H29FO6/c1-12(2)17-20(30)23-27(34-23)25(3)10-9-14-18(15(25)11-16-26(27,33-16)22(17)28)21(32-24(14)31)19(29)13-7-5-4-6-8-13/h4-8,12,15-17,20,22-23,30-31H,9-11H2,1-3H3/t15?,16-,17?,20+,22-,23-,25-,26+,27+/m0/s1 |
| InChIKey | SUCRIYCCESTMQQ-OQLLVZDFSA-N |
| XLogP | 3.92 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|