C20H38N4O3 — CID 142489135
N-[6-[[(E)-but-2-enoyl]amino]hexyl]-N'-ethyl-N'-[2-(methylamino)ethyl]pentanediamide (PubChem CID 142489135) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[6-[[(E)-but-2-enoyl]amino]hexyl]-N'-ethyl-N'-[2-(methylamino)ethyl]pentanediamide.
| Compound Name | N-[6-[[(E)-but-2-enoyl]amino]hexyl]-N'-ethyl-N'-[2-(methylamino)ethyl]pentanediamide |
|---|---|
| PubChem CID | 142489135 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | N-[6-[[(E)-but-2-enoyl]amino]hexyl]-N'-ethyl-N'-[2-(methylamino)ethyl]pentanediamide |
| SMILES | C/C=C/C(=O)NCCCCCCNC(=O)CCCC(=O)N(CC)CCNC |
| InChI | InChI=1S/C20H38N4O3/c1-4-11-18(25)22-14-8-6-7-9-15-23-19(26)12-10-13-20(27)24(5-2)17-16-21-3/h4,11,21H,5-10,12-17H2,1-3H3,(H,22,25)(H,23,26)/b11-4+ |
| InChIKey | YKAIPBIFOADOJE-NYYWCZLTSA-N |
| XLogP | 1.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|