C18H11Cl2N3O4 — CID 142490036
N-(5,6-dichloro-3-pyridinyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide (PubChem CID 142490036) has the molecular formula C18H11Cl2N3O4 and a molecular weight of 404.21 g/mol. Its IUPAC name is N-(5,6-dichloro-3-pyridinyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide.
| Compound Name | N-(5,6-dichloro-3-pyridinyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide |
|---|---|
| PubChem CID | 142490036 |
| Molecular Formula | C18H11Cl2N3O4 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N-(5,6-dichloro-3-pyridinyl)-5,6-dihydroxy-3-(2-methyl-4-pyridinyl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide |
| SMILES | Cc1cc(-c2c(C(=O)Nc3cnc(Cl)c(Cl)c3)c3oc2c(O)c3O)ccn1 |
| InChI | InChI=1S/C18H11Cl2N3O4/c1-7-4-8(2-3-21-7)11-12(16-14(25)13(24)15(11)27-16)18(26)23-9-5-10(19)17(20)22-6-9/h2-6,24-25H,1H3,(H,23,26) |
| InChIKey | AERRVABVTUUWHB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|