C19H14Cl2N2O4 — CID 166863605
N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(4-methyl-3H-pyridin-4-yl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide (PubChem CID 166863605) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(4-methyl-3H-pyridin-4-yl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(4-methyl-3H-pyridin-4-yl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide |
|---|---|
| PubChem CID | 166863605 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5,6-dihydroxy-3-(4-methyl-3H-pyridin-4-yl)-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene-2-carboxamide |
| SMILES | CC1(c2c(C(=O)Nc3ccc(Cl)c(Cl)c3)c3oc2c(O)c3O)C=CN=CC1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c1-19(4-6-22-7-5-19)13-12(16-14(24)15(25)17(13)27-16)18(26)23-9-2-3-10(20)11(21)8-9/h2-4,6-8,24-25H,5H2,1H3,(H,23,26) |
| InChIKey | GFGHNMPTXCUFOA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|