C7H7Cl2N3O — CID 130609491
2-amino-N-(5,6-dichloro-3-pyridinyl)acetamide (PubChem CID 130609491) has the molecular formula C7H7Cl2N3O and a molecular weight of 220.06 g/mol. Its IUPAC name is 2-amino-N-(5,6-dichloro-3-pyridinyl)acetamide.
| Compound Name | 2-amino-N-(5,6-dichloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 130609491 |
| Molecular Formula | C7H7Cl2N3O |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2-amino-N-(5,6-dichloro-3-pyridinyl)acetamide |
| SMILES | NCC(=O)Nc1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H7Cl2N3O/c8-5-1-4(3-11-7(5)9)12-6(13)2-10/h1,3H,2,10H2,(H,12,13) |
| InChIKey | PFLCBSHILUNARF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|