C18H18ClF3N2O2 — CID 142496618
3-chloro-1-ethyl-5-(N-methoxy-C-propan-2-ylcarbonimidoyl)-6-(2,4,6-trifluorophenyl)pyridin-2-one (PubChem CID 142496618) has the molecular formula C18H18ClF3N2O2 and a molecular weight of 386.80 g/mol. Its IUPAC name is 3-chloro-1-ethyl-5-(N-methoxy-C-propan-2-ylcarbonimidoyl)-6-(2,4,6-trifluorophenyl)pyridin-2-one.
| Compound Name | 3-chloro-1-ethyl-5-(N-methoxy-C-propan-2-ylcarbonimidoyl)-6-(2,4,6-trifluorophenyl)pyridin-2-one |
|---|---|
| PubChem CID | 142496618 |
| Molecular Formula | C18H18ClF3N2O2 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-chloro-1-ethyl-5-(N-methoxy-C-propan-2-ylcarbonimidoyl)-6-(2,4,6-trifluorophenyl)pyridin-2-one |
| SMILES | CCn1c(-c2c(F)cc(F)cc2F)c(C(=NOC)C(C)C)cc(Cl)c1=O |
| InChI | InChI=1S/C18H18ClF3N2O2/c1-5-24-17(15-13(21)6-10(20)7-14(15)22)11(8-12(19)18(24)25)16(9(2)3)23-26-4/h6-9H,5H2,1-4H3 |
| InChIKey | CDQVLYMLUJSEPV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|