About ethane;3-ethyl-3-methyloxetane;methanamine
ethane;3-ethyl-3-methyloxetane;methanamine (PubChem CID 142501771) has the molecular formula C9H23NO
and a molecular weight of 161.29 g/mol. Its IUPAC name is ethane;3-ethyl-3-methyloxetane;methanamine.
Molecular Properties
| Compound Name | ethane;3-ethyl-3-methyloxetane;methanamine |
| PubChem CID | 142501771 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | ethane;3-ethyl-3-methyloxetane;methanamine |
| SMILES | CC.CCC1(C)COC1.CN |
| InChI | InChI=1S/C6H12O.C2H6.CH5N/c1-3-6(2)4-7-5-6;2*1-2/h3-5H2,1-2H3;1-2H3;2H2,1H3 |
| InChIKey | DUXQNGJLKXTUHC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-ethyl-3-methyloxetane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-3-methyloxetane;methanamine?
The IUPAC name of ethane;3-ethyl-3-methyloxetane;methanamine (CID 142501771) is ethane;3-ethyl-3-methyloxetane;methanamine.
What is the SMILES notation for ethane;3-ethyl-3-methyloxetane;methanamine?
The canonical SMILES for ethane;3-ethyl-3-methyloxetane;methanamine is CC.CCC1(C)COC1.CN.
What is the InChIKey of ethane;3-ethyl-3-methyloxetane;methanamine?
The InChIKey is DUXQNGJLKXTUHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C2H6.CH5N/c1-3-6(2)4-7-5-6;2*1-2/h3-5H2,1-2H3;1-2H3;2H2,1H3.
What are the key properties of ethane;3-ethyl-3-methyloxetane;methanamine?
ethane;3-ethyl-3-methyloxetane;methanamine has a molecular weight of 161.29 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-3-methyloxetane;methanamine is sourced from PubChem (CID 142501771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).