About 3-ethyl-3-methyloxetane;methane;2-methyloxirane
3-ethyl-3-methyloxetane;methane;2-methyloxirane (PubChem CID 161094620) has the molecular formula C11H26O2
and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-ethyl-3-methyloxetane;methane;2-methyloxirane.
Molecular Properties
| Compound Name | 3-ethyl-3-methyloxetane;methane;2-methyloxirane |
| PubChem CID | 161094620 |
| Molecular Formula | C11H26O2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.19 |
| IUPAC Name | 3-ethyl-3-methyloxetane;methane;2-methyloxirane |
| SMILES | C.C.CC1CO1.CCC1(C)COC1 |
| InChI | InChI=1S/C6H12O.C3H6O.2CH4/c1-3-6(2)4-7-5-6;1-3-2-4-3;;/h3-5H2,1-2H3;3H,2H2,1H3;2*1H4 |
| InChIKey | UHPXDKLQCXJSSO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-methyloxetane;methane;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methyloxetane;methane;2-methyloxirane?
The IUPAC name of 3-ethyl-3-methyloxetane;methane;2-methyloxirane (CID 161094620) is 3-ethyl-3-methyloxetane;methane;2-methyloxirane.
What is the SMILES notation for 3-ethyl-3-methyloxetane;methane;2-methyloxirane?
The canonical SMILES for 3-ethyl-3-methyloxetane;methane;2-methyloxirane is C.C.CC1CO1.CCC1(C)COC1.
What is the InChIKey of 3-ethyl-3-methyloxetane;methane;2-methyloxirane?
The InChIKey is UHPXDKLQCXJSSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C3H6O.2CH4/c1-3-6(2)4-7-5-6;1-3-2-4-3;;/h3-5H2,1-2H3;3H,2H2,1H3;2*1H4.
What are the key properties of 3-ethyl-3-methyloxetane;methane;2-methyloxirane?
3-ethyl-3-methyloxetane;methane;2-methyloxirane has a molecular weight of 190.33 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methyloxetane;methane;2-methyloxirane is sourced from PubChem (CID 161094620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).