C9H18O2 — CID 151533487
2,2-diethyl-5-methyl-1,4-dioxane (PubChem CID 151533487) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2,2-diethyl-5-methyl-1,4-dioxane.
| Compound Name | 2,2-diethyl-5-methyl-1,4-dioxane |
|---|---|
| PubChem CID | 151533487 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2,2-diethyl-5-methyl-1,4-dioxane |
| SMILES | CCC1(CC)COC(C)CO1 |
| InChI | InChI=1S/C9H18O2/c1-4-9(5-2)7-10-8(3)6-11-9/h8H,4-7H2,1-3H3 |
| InChIKey | PWYVRDVSHIJHJC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |