C8H15NO2 — CID 170728203
2,7-dimethyl-5,8-dioxa-2-azaspiro[3.5]nonane (PubChem CID 170728203) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2,7-dimethyl-5,8-dioxa-2-azaspiro[3.5]nonane.
| Compound Name | 2,7-dimethyl-5,8-dioxa-2-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170728203 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2,7-dimethyl-5,8-dioxa-2-azaspiro[3.5]nonane |
| SMILES | CC1COC2(CO1)CN(C)C2 |
| InChI | InChI=1S/C8H15NO2/c1-7-3-11-8(6-10-7)4-9(2)5-8/h7H,3-6H2,1-2H3 |
| InChIKey | XNIFBXDMCFPXIJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |