C9H18N2O — CID 176639327
(7R)-2,7,8-trimethyl-5-oxa-2,8-diazaspiro[3.5]nonane (PubChem CID 176639327) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (7R)-2,7,8-trimethyl-5-oxa-2,8-diazaspiro[3.5]nonane.
| Compound Name | (7R)-2,7,8-trimethyl-5-oxa-2,8-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176639327 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (7R)-2,7,8-trimethyl-5-oxa-2,8-diazaspiro[3.5]nonane |
| SMILES | C[C@@H]1COC2(CN(C)C2)CN1C |
| InChI | InChI=1S/C9H18N2O/c1-8-4-12-9(7-11(8)3)5-10(2)6-9/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | XCMIOCSNLNMURF-MRVPVSSYSA-N |
| XLogP | 0.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |