C9H15NO2 — CID 164646665
7,8-dimethyl-1-oxa-7-azaspiro[4.4]nonan-3-one (PubChem CID 164646665) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 7,8-dimethyl-1-oxa-7-azaspiro[4.4]nonan-3-one.
| Compound Name | 7,8-dimethyl-1-oxa-7-azaspiro[4.4]nonan-3-one |
|---|---|
| PubChem CID | 164646665 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 7,8-dimethyl-1-oxa-7-azaspiro[4.4]nonan-3-one |
| SMILES | CC1CC2(CC(=O)CO2)CN1C |
| InChI | InChI=1S/C9H15NO2/c1-7-3-9(6-10(7)2)4-8(11)5-12-9/h7H,3-6H2,1-2H3 |
| InChIKey | ABBHJIDCFMVBMU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |