C16H16N2O3 — CID 142502464
N-(furan-2-ylmethyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide (PubChem CID 142502464) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 142502464 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
| SMILES | CC1(C)C(=O)Nc2cc(C(=O)NCc3ccco3)ccc21 |
| InChI | InChI=1S/C16H16N2O3/c1-16(2)12-6-5-10(8-13(12)18-15(16)20)14(19)17-9-11-4-3-7-21-11/h3-8H,9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | YUHPCAYVGDXMFV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |