C33H33Br — CID 142508933
2'-bromo-3'-[(1Z)-buta-1,3-dienyl]-2,7-ditert-butylspiro[fluorene-9,1'-indene] (PubChem CID 142508933) has the molecular formula C33H33Br and a molecular weight of 509.53 g/mol. Its IUPAC name is 2'-bromo-3'-[(1Z)-buta-1,3-dienyl]-2,7-ditert-butylspiro[fluorene-9,1'-indene].
| Compound Name | 2'-bromo-3'-[(1Z)-buta-1,3-dienyl]-2,7-ditert-butylspiro[fluorene-9,1'-indene] |
|---|---|
| PubChem CID | 142508933 |
| Molecular Formula | C33H33Br |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2'-bromo-3'-[(1Z)-buta-1,3-dienyl]-2,7-ditert-butylspiro[fluorene-9,1'-indene] |
| SMILES | C=C/C=C\C1=C(Br)C2(c3ccccc31)c1cc(C(C)(C)C)ccc1-c1ccc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C33H33Br/c1-8-9-12-26-23-13-10-11-14-27(23)33(30(26)34)28-19-21(31(2,3)4)15-17-24(28)25-18-16-22(20-29(25)33)32(5,6)7/h8-20H,1H2,2-7H3/b12-9- |
| InChIKey | NEEDQLZGCRHELY-XFXZXTDPSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|