C31H45N3 — CID 142511133
(3E,6Z)-8-cyclopropylidene-6-N-[(5Z)-7-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylnona-5,7-dien-4-ylidene]-5-N,3-dimethylnona-1,3,6-triene-5,6-diimine (PubChem CID 142511133) has the molecular formula C31H45N3 and a molecular weight of 459.72 g/mol. Its IUPAC name is (3E,6Z)-8-cyclopropylidene-6-N-[(5Z)-7-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylnona-5,7-dien-4-ylidene]-5-N,3-dimethylnona-1,3,6-triene-5,6-diimine.
| Compound Name | (3E,6Z)-8-cyclopropylidene-6-N-[(5Z)-7-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylnona-5,7-dien-4-ylidene]-5-N,3-dimethylnona-1,3,6-triene-5,6-diimine |
|---|---|
| PubChem CID | 142511133 |
| Molecular Formula | C31H45N3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.36 |
| IUPAC Name | (3E,6Z)-8-cyclopropylidene-6-N-[(5Z)-7-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-3-methylnona-5,7-dien-4-ylidene]-5-N,3-dimethylnona-1,3,6-triene-5,6-diimine |
| SMILES | C=C/C(C)=C/C(=N\C)C(=C/C(C)=C1CC1)/N=C(\C=C/C(=CC)C1=CCN(CC)CC1)C(C)CC |
| InChI | InChI=1S/C31H45N3/c1-9-23(5)21-30(32-8)31(22-25(7)27-13-14-27)33-29(24(6)10-2)16-15-26(11-3)28-17-19-34(12-4)20-18-28/h9,11,15-17,21-22,24H,1,10,12-14,18-20H2,2-8H3/b16-15-,23-21+,26-11?,31-22-,32-30+,33-29+ |
| InChIKey | LYENJLMMPLFANJ-ZCJKCFPVSA-N |
| XLogP | 7.83 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|