C34H51N5 — CID 142511187
(2E)-1-[4-cyclopropylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511187) has the molecular formula C34H51N5 and a molecular weight of 529.82 g/mol. Its IUPAC name is (2E)-1-[4-cyclopropylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (2E)-1-[4-cyclopropylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511187 |
| Molecular Formula | C34H51N5 |
| Molecular Weight | 529.82 g/mol |
| Exact Mass | 529.41 |
| IUPAC Name | (2E)-1-[4-cyclopropylidene-7-(3-methylpiperazin-1-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CC2)N2C=C(N3CCNC(C)C3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C24H31N5.C10H20/c1-16(2)17(3)12-21(25-5)22-13-23(19-6-7-19)29-15-20(8-9-24(29)27-22)28-11-10-26-18(4)14-28;1-5-7-8-10(4)9(3)6-2/h8-9,12-13,15,18,26H,1,6-7,10-11,14H2,2-5H3;8-9H,5-7H2,1-4H3/b17-12+,25-21+;10-8- |
| InChIKey | ZTRDPXQLSKHDPC-ACZXFGLPSA-N |
| XLogP | 7.71 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.82 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|