C27H37N5 — CID 142511368
(2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine (PubChem CID 142511368) has the molecular formula C27H37N5 and a molecular weight of 431.63 g/mol. Its IUPAC name is (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511368 |
| Molecular Formula | C27H37N5 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C)[C@@H](C)C3)C=C(C)C2=N1 |
| InChI | InChI=1S/C27H37N5/c1-18(2)19(3)14-24(28-6)25-15-26(22-9-8-10-22)32-17-23(13-20(4)27(32)29-25)31-12-11-30(7)21(5)16-31/h13-15,17,21H,1,8-12,16H2,2-7H3/b19-14+,28-24+/t21-/m0/s1 |
| InChIKey | FRRQGEFKZKDDJC-FBSSSQCKSA-N |
| XLogP | 5.05 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|