C37H57N5 — CID 142511367
(2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene (PubChem CID 142511367) has the molecular formula C37H57N5 and a molecular weight of 571.90 g/mol. Its IUPAC name is (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene.
| Compound Name | (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
|---|---|
| PubChem CID | 142511367 |
| Molecular Formula | C37H57N5 |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 571.46 |
| IUPAC Name | (2E)-1-[4-cyclobutylidene-7-[(3S)-3,4-dimethylpiperazin-1-yl]-9-methylpyrido[1,2-a]pyrimidin-2-yl]-N,3,4-trimethylpenta-2,4-dien-1-imine;(Z)-3,4-dimethyloct-4-ene |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCN(C)[C@@H](C)C3)C=C(C)C2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C27H37N5.C10H20/c1-18(2)19(3)14-24(28-6)25-15-26(22-9-8-10-22)32-17-23(13-20(4)27(32)29-25)31-12-11-30(7)21(5)16-31;1-5-7-8-10(4)9(3)6-2/h13-15,17,21H,1,8-12,16H2,2-7H3;8-9H,5-7H2,1-4H3/b19-14+,28-24+;10-8-/t21-;/m0./s1 |
| InChIKey | WYQJHDNURJLQLD-DQFAJMPTSA-N |
| XLogP | 8.83 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|