C25H33N5 — CID 142511415
(E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 142511415) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine.
| Compound Name | (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
|---|---|
| PubChem CID | 142511415 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCNCC3)C=CC2=N1 |
| InChI | InChI=1S/C25H33N5/c1-5-18(2)19(3)15-22(26-4)23-16-24(20-7-6-8-20)30-17-21(9-10-25(30)28-23)29-13-11-27-12-14-29/h9-10,15-17,27H,2,5-8,11-14H2,1,3-4H3/b19-15+,26-22+ |
| InChIKey | FNPNHGNBKISOAY-VOJVLUJFSA-N |
| XLogP | 4.32 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|