C20H17NO5 — CID 142512643
dibenzyl (1S)-1-isocyanatocyclopropane-1,2-dicarboxylate (PubChem CID 142512643) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is dibenzyl (1S)-1-isocyanatocyclopropane-1,2-dicarboxylate.
| Compound Name | dibenzyl (1S)-1-isocyanatocyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142512643 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | dibenzyl (1S)-1-isocyanatocyclopropane-1,2-dicarboxylate |
| SMILES | O=C=N[C@@]1(C(=O)OCc2ccccc2)CC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H17NO5/c22-14-21-20(19(24)26-13-16-9-5-2-6-10-16)11-17(20)18(23)25-12-15-7-3-1-4-8-15/h1-10,17H,11-13H2/t17?,20-/m0/s1 |
| InChIKey | MDYSVZGWLLCQLJ-OZBJMMHXSA-N |
| XLogP | 2.57 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|