C14H30N2 — CID 142516512
N,N-bis(ethenyl)-N'-methylprop-2-enimidamide;ethane (PubChem CID 142516512) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N,N-bis(ethenyl)-N'-methylprop-2-enimidamide;ethane.
| Compound Name | N,N-bis(ethenyl)-N'-methylprop-2-enimidamide;ethane |
|---|---|
| PubChem CID | 142516512 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N,N-bis(ethenyl)-N'-methylprop-2-enimidamide;ethane |
| SMILES | C=C/C(=N\C)N(C=C)C=C.CC.CC.CC |
| InChI | InChI=1S/C8H12N2.3C2H6/c1-5-8(9-4)10(6-2)7-3;3*1-2/h5-7H,1-3H2,4H3;3*1-2H3/b9-8+;;; |
| InChIKey | WVUYQWKCZDXBJE-BILRHTGOSA-N |
| XLogP | 4.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|