C18H26N2O — CID 142517155
N-[(1S)-1-[4-[(E)-3-(2-methylbutylideneamino)but-2-en-2-yl]phenyl]ethyl]formamide (PubChem CID 142517155) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(E)-3-(2-methylbutylideneamino)but-2-en-2-yl]phenyl]ethyl]formamide.
| Compound Name | N-[(1S)-1-[4-[(E)-3-(2-methylbutylideneamino)but-2-en-2-yl]phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 142517155 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-[(1S)-1-[4-[(E)-3-(2-methylbutylideneamino)but-2-en-2-yl]phenyl]ethyl]formamide |
| SMILES | CCC(C)/C=N/C(C)=C(\C)c1ccc([C@H](C)NC=O)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-6-13(2)11-19-15(4)14(3)17-7-9-18(10-8-17)16(5)20-12-21/h7-13,16H,6H2,1-5H3,(H,20,21)/b15-14+,19-11+/t13?,16-/m0/s1 |
| InChIKey | ABFRXNDTNUCANY-VONPAMNLSA-N |
| XLogP | 4.36 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|