C18H21F2NO — CID 170955685
N-[1-[4-[(2E,4E,6Z)-3,5-difluoronona-2,4,6-trien-4-yl]phenyl]ethyl]formamide (PubChem CID 170955685) has the molecular formula C18H21F2NO and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[1-[4-[(2E,4E,6Z)-3,5-difluoronona-2,4,6-trien-4-yl]phenyl]ethyl]formamide.
| Compound Name | N-[1-[4-[(2E,4E,6Z)-3,5-difluoronona-2,4,6-trien-4-yl]phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 170955685 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[1-[4-[(2E,4E,6Z)-3,5-difluoronona-2,4,6-trien-4-yl]phenyl]ethyl]formamide |
| SMILES | C/C=C(F)\C(=C(F)/C=C\CC)c1ccc(C(C)NC=O)cc1 |
| InChI | InChI=1S/C18H21F2NO/c1-4-6-7-17(20)18(16(19)5-2)15-10-8-14(9-11-15)13(3)21-12-22/h5-13H,4H2,1-3H3,(H,21,22)/b7-6-,16-5+,18-17+ |
| InChIKey | QMELCJHMZNPAPW-SQZIXHDHSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|