C51H35F3N2O3S — CID 142521167
[3-[2-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-quinolin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 142521167) has the molecular formula C51H35F3N2O3S and a molecular weight of 812.91 g/mol. Its IUPAC name is [3-[2-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-quinolin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[2-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-quinolin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142521167 |
| Molecular Formula | C51H35F3N2O3S |
| Molecular Weight | 812.91 g/mol |
| Exact Mass | 812.23 |
| IUPAC Name | [3-[2-(4-cyclohexa-1,5-dien-1-yl-6-phenyl-3-pyridinyl)phenyl]-5-[2-(4-quinolin-2-ylphenyl)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(-c2ccccc2-c2ccc(-c3ccc4ccccc4n3)cc2)cc(-c2ccccc2-c2cnc(-c3ccccc3)cc2C2=CCCC=C2)c1)C(F)(F)F |
| InChI | InChI=1S/C51H35F3N2O3S/c52-51(53,54)60(57,58)59-41-30-39(43-19-9-8-18-42(43)35-23-25-38(26-24-35)49-28-27-37-17-7-12-22-48(37)56-49)29-40(31-41)44-20-10-11-21-45(44)47-33-55-50(36-15-5-2-6-16-36)32-46(47)34-13-3-1-4-14-34/h2-3,5-33H,1,4H2 |
| InChIKey | SRPYKOJEFXAQQI-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.91 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|