C24H28F2N4OS — CID 142522766
1-[amino-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142522766) has the molecular formula C24H28F2N4OS and a molecular weight of 458.58 g/mol. Its IUPAC name is 1-[amino-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142522766 |
| Molecular Formula | C24H28F2N4OS |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[amino-[4-[(3,3-difluoropyrrolidin-1-yl)methyl]phenyl]-λ4-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | NS(=NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1ccc(CN2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C24H28F2N4OS/c25-24(26)11-12-30(15-24)14-16-7-9-19(10-8-16)32(27)29-23(31)28-22-20-5-1-3-17(20)13-18-4-2-6-21(18)22/h7-10,13H,1-6,11-12,14-15H2,(H3,27,28,29,31) |
| InChIKey | YUARQEFRVARJFS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |