C22H36FN3O3S — CID 142522768
2-(5-aminosulfanyl-2-methylfuran-3-yl)propan-2-ol;N-[4-fluoro-2,6-di(propan-2-yl)phenyl]formamide;methanamine (PubChem CID 142522768) has the molecular formula C22H36FN3O3S and a molecular weight of 441.61 g/mol. Its IUPAC name is 2-(5-aminosulfanyl-2-methylfuran-3-yl)propan-2-ol;N-[4-fluoro-2,6-di(propan-2-yl)phenyl]formamide;methanamine.
| Compound Name | 2-(5-aminosulfanyl-2-methylfuran-3-yl)propan-2-ol;N-[4-fluoro-2,6-di(propan-2-yl)phenyl]formamide;methanamine |
|---|---|
| PubChem CID | 142522768 |
| Molecular Formula | C22H36FN3O3S |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-(5-aminosulfanyl-2-methylfuran-3-yl)propan-2-ol;N-[4-fluoro-2,6-di(propan-2-yl)phenyl]formamide;methanamine |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1NC=O.CN.Cc1oc(SN)cc1C(C)(C)O |
| InChI | InChI=1S/C13H18FNO.C8H13NO2S.CH5N/c1-8(2)11-5-10(14)6-12(9(3)4)13(11)15-7-16;1-5-6(8(2,3)10)4-7(11-5)12-9;1-2/h5-9H,1-4H3,(H,15,16);4,10H,9H2,1-3H3;2H2,1H3 |
| InChIKey | BBMAUZHZXAQFQS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|