C7H10F3NO3 — CID 142528127
N-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide (PubChem CID 142528127) has the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. Its IUPAC name is N-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide.
| Compound Name | N-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide |
|---|---|
| PubChem CID | 142528127 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide |
| SMILES | CC(=O)NOC1CC(OC(F)(F)F)C1 |
| InChI | InChI=1S/C7H10F3NO3/c1-4(12)11-14-6-2-5(3-6)13-7(8,9)10/h5-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | ZFKUKIUXKWAEMH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|