C16H23F3N2O6 — CID 165399667
methyl 4-[[[2-[3-(trifluoromethoxy)cyclobutyl]oxyacetyl]amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 165399667) has the molecular formula C16H23F3N2O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is methyl 4-[[[2-[3-(trifluoromethoxy)cyclobutyl]oxyacetyl]amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[[2-[3-(trifluoromethoxy)cyclobutyl]oxyacetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 165399667 |
| Molecular Formula | C16H23F3N2O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 4-[[[2-[3-(trifluoromethoxy)cyclobutyl]oxyacetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(=O)NNC(=O)COC2CC(OC(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C16H23F3N2O6/c1-25-15(24)10-4-2-9(3-5-10)14(23)21-20-13(22)8-26-11-6-12(7-11)27-16(17,18)19/h9-12H,2-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | WYBPLSRDAQMFPL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|