C11H17F3N2O3 — CID 162613297
N-(1-methylazetidin-3-yl)-2-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide (PubChem CID 162613297) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is N-(1-methylazetidin-3-yl)-2-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide.
| Compound Name | N-(1-methylazetidin-3-yl)-2-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide |
|---|---|
| PubChem CID | 162613297 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(1-methylazetidin-3-yl)-2-[3-(trifluoromethoxy)cyclobutyl]oxyacetamide |
| SMILES | CN1CC(NC(=O)COC2CC(OC(F)(F)F)C2)C1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-16-4-7(5-16)15-10(17)6-18-8-2-9(3-8)19-11(12,13)14/h7-9H,2-6H2,1H3,(H,15,17) |
| InChIKey | NKAOAVWJTMUCLH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |