C12H12O — CID 142535471
1,7,8,9-tetrahydrocyclopenta[h]isochromene (PubChem CID 142535471) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1,7,8,9-tetrahydrocyclopenta[h]isochromene.
| Compound Name | 1,7,8,9-tetrahydrocyclopenta[h]isochromene |
|---|---|
| PubChem CID | 142535471 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1,7,8,9-tetrahydrocyclopenta[h]isochromene |
| SMILES | C1=Cc2ccc3c(c2CO1)CCC3 |
| InChI | InChI=1S/C12H12O/c1-2-9-4-5-10-6-7-13-8-12(10)11(9)3-1/h4-7H,1-3,8H2 |
| InChIKey | OSVCSFZABBSVRW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |