C10H8O2S — CID 146570561
7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxole-2-thione (PubChem CID 146570561) has the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. Its IUPAC name is 7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxole-2-thione.
| Compound Name | 7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxole-2-thione |
|---|---|
| PubChem CID | 146570561 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 7,8-dihydro-6H-cyclopenta[g][1,3]benzodioxole-2-thione |
| SMILES | S=c1oc2ccc3c(c2o1)CCC3 |
| InChI | InChI=1S/C10H8O2S/c13-10-11-8-5-4-6-2-1-3-7(6)9(8)12-10/h4-5H,1-3H2 |
| InChIKey | LNBBUSKTGAXZES-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|