C21H31N4O7PS — CID 142535867
2-[[[(3S)-3-hydroxy-2-[1-[4-(methylamino)-2-oxopyrimidin-1-yl]ethoxy]-5-methylsulfanylpentoxy]-phenoxyphosphoryl]amino]acetaldehyde (PubChem CID 142535867) has the molecular formula C21H31N4O7PS and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-[[[(3S)-3-hydroxy-2-[1-[4-(methylamino)-2-oxopyrimidin-1-yl]ethoxy]-5-methylsulfanylpentoxy]-phenoxyphosphoryl]amino]acetaldehyde.
| Compound Name | 2-[[[(3S)-3-hydroxy-2-[1-[4-(methylamino)-2-oxopyrimidin-1-yl]ethoxy]-5-methylsulfanylpentoxy]-phenoxyphosphoryl]amino]acetaldehyde |
|---|---|
| PubChem CID | 142535867 |
| Molecular Formula | C21H31N4O7PS |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-[[[(3S)-3-hydroxy-2-[1-[4-(methylamino)-2-oxopyrimidin-1-yl]ethoxy]-5-methylsulfanylpentoxy]-phenoxyphosphoryl]amino]acetaldehyde |
| SMILES | CNc1ccn(C(C)OC(COP(=O)(NCC=O)Oc2ccccc2)[C@@H](O)CCSC)c(=O)n1 |
| InChI | InChI=1S/C21H31N4O7PS/c1-16(25-12-9-20(22-2)24-21(25)28)31-19(18(27)10-14-34-3)15-30-33(29,23-11-13-26)32-17-7-5-4-6-8-17/h4-9,12-13,16,18-19,27H,10-11,14-15H2,1-3H3,(H,23,29)(H,22,24,28)/t16?,18-,19?,33?/m0/s1 |
| InChIKey | JYVOBXCHZMNUGK-IHFPPJMYSA-N |
| XLogP | 2.29 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|