About (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol
(5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol (PubChem CID 142537567) has the molecular formula C8H16F2N2O2
and a molecular weight of 210.22 g/mol. Its IUPAC name is (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol |
| PubChem CID | 142537567 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol |
| SMILES | CO[C@H]1C(C)C(O)C(N)C(F)(F)C1N |
| InChI | InChI=1S/C8H16F2N2O2/c1-3-4(13)6(11)8(9,10)7(12)5(3)14-2/h3-7,13H,11-12H2,1-2H3/t3?,4?,5-,6?,7?/m0/s1 |
| InChIKey | LEHPYEWPZNSLQV-JAPDVUMRSA-N |
| XLogP | -0.70 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol?
The IUPAC name of (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol (CID 142537567) is (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol.
What is the SMILES notation for (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol?
The canonical SMILES for (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol is CO[C@H]1C(C)C(O)C(N)C(F)(F)C1N.
What is the InChIKey of (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol?
The InChIKey is LEHPYEWPZNSLQV-JAPDVUMRSA-N. The full InChI is InChI=1S/C8H16F2N2O2/c1-3-4(13)6(11)8(9,10)7(12)5(3)14-2/h3-7,13H,11-12H2,1-2H3/t3?,4?,5-,6?,7?/m0/s1.
What are the key properties of (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol?
(5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol has a molecular weight of 210.22 g/mol, XLogP of -0.70, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,4-diamino-3,3-difluoro-5-methoxy-6-methylcyclohexan-1-ol is sourced from PubChem (CID 142537567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).