C25H32F6N4O3 — CID 142538384
ethane;1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2-cyclopropylpyrimidin-5-yl)cyclopropanecarbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 142538384) has the molecular formula C25H32F6N4O3 and a molecular weight of 550.54 g/mol. Its IUPAC name is ethane;1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2-cyclopropylpyrimidin-5-yl)cyclopropanecarbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethane;1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2-cyclopropylpyrimidin-5-yl)cyclopropanecarbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 142538384 |
| Molecular Formula | C25H32F6N4O3 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | ethane;1,1,1,3,3,3-hexafluoropropan-2-yl 1-[1-(2-cyclopropylpyrimidin-5-yl)cyclopropanecarbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC.O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCCN2C(=O)C2(c3cnc(C4CC4)nc3)CC2)CC1 |
| InChI | InChI=1S/C23H26F6N4O3.C2H6/c24-22(25,26)17(23(27,28)29)36-19(35)32-10-7-20(8-11-32)4-1-9-33(20)18(34)21(5-6-21)15-12-30-16(31-13-15)14-2-3-14;1-2/h12-14,17H,1-11H2;1-2H3 |
| InChIKey | QNLUCJQMPZPYAH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |