C22H27F6N5O3 — CID 164732527
1,1,1,3,3,3-hexafluoropropan-2-yl 1-[7-(aziridin-1-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 164732527) has the molecular formula C22H27F6N5O3 and a molecular weight of 523.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[7-(aziridin-1-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[7-(aziridin-1-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 164732527 |
| Molecular Formula | C22H27F6N5O3 |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-[7-(aziridin-1-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-2-carbonyl]-1,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCCN2C(=O)c2cn3c(n2)CC(N2CC2)CC3)CC1 |
| InChI | InChI=1S/C22H27F6N5O3/c23-21(24,25)18(22(26,27)28)36-19(35)31-8-4-20(5-9-31)3-1-6-33(20)17(34)15-13-32-7-2-14(30-10-11-30)12-16(32)29-15/h13-14,18H,1-12H2 |
| InChIKey | MHLIRBMPSDMTRA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|