C37H51ClO4 — CID 142548338
benzyl 10-formyl-4a,6b,9,9,12a-pentamethyl-13-oxo-2,3,4,5,6,6a,6a,7,8,8a,10,11,12,14b-tetradecahydro-1H-picene-2-carboxylate;chloromethane (PubChem CID 142548338) has the molecular formula C37H51ClO4 and a molecular weight of 595.26 g/mol. Its IUPAC name is benzyl 10-formyl-4a,6b,9,9,12a-pentamethyl-13-oxo-2,3,4,5,6,6a,6a,7,8,8a,10,11,12,14b-tetradecahydro-1H-picene-2-carboxylate;chloromethane.
| Compound Name | benzyl 10-formyl-4a,6b,9,9,12a-pentamethyl-13-oxo-2,3,4,5,6,6a,6a,7,8,8a,10,11,12,14b-tetradecahydro-1H-picene-2-carboxylate;chloromethane |
|---|---|
| PubChem CID | 142548338 |
| Molecular Formula | C37H51ClO4 |
| Molecular Weight | 595.26 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | benzyl 10-formyl-4a,6b,9,9,12a-pentamethyl-13-oxo-2,3,4,5,6,6a,6a,7,8,8a,10,11,12,14b-tetradecahydro-1H-picene-2-carboxylate;chloromethane |
| SMILES | CC12CCC(C(=O)OCc3ccccc3)CC1C1=CC(=O)C3C(C)(CCC4C(C)(C)C(C=O)CCC43C)C1CC2.CCl |
| InChI | InChI=1S/C36H48O4.CH3Cl/c1-33(2)25(21-37)12-17-36(5)30(33)14-18-35(4)27-13-16-34(3)15-11-24(19-28(34)26(27)20-29(38)31(35)36)32(39)40-22-23-9-7-6-8-10-23;1-2/h6-10,20-21,24-25,27-28,30-31H,11-19,22H2,1-5H3;1H3 |
| InChIKey | COLXIUXVAHFDNP-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.26 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|