C29H44N2O4 — CID 170133531
10-[(2-amino-2-oxoethyl)amino]-4a,6b,9,12a-tetramethyl-13-oxo-1,2,3,4,5,6,6a,6a,7,8,8a,9,10,11,12,14b-hexadecahydropicene-2-carboxylic acid (PubChem CID 170133531) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is 10-[(2-amino-2-oxoethyl)amino]-4a,6b,9,12a-tetramethyl-13-oxo-1,2,3,4,5,6,6a,6a,7,8,8a,9,10,11,12,14b-hexadecahydropicene-2-carboxylic acid.
| Compound Name | 10-[(2-amino-2-oxoethyl)amino]-4a,6b,9,12a-tetramethyl-13-oxo-1,2,3,4,5,6,6a,6a,7,8,8a,9,10,11,12,14b-hexadecahydropicene-2-carboxylic acid |
|---|---|
| PubChem CID | 170133531 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 10-[(2-amino-2-oxoethyl)amino]-4a,6b,9,12a-tetramethyl-13-oxo-1,2,3,4,5,6,6a,6a,7,8,8a,9,10,11,12,14b-hexadecahydropicene-2-carboxylic acid |
| SMILES | CC1C(NCC(N)=O)CCC2(C)C1CCC1(C)C3CCC4(C)CCC(C(=O)O)CC4C3=CC(=O)C12 |
| InChI | InChI=1S/C29H44N2O4/c1-16-19-7-11-29(4)20-6-10-27(2)9-5-17(26(34)35)13-21(27)18(20)14-23(32)25(29)28(19,3)12-8-22(16)31-15-24(30)33/h14,16-17,19-22,25,31H,5-13,15H2,1-4H3,(H2,30,33)(H,34,35) |
| InChIKey | DHRMSFMKGAZCJF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |