About ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile
ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile (PubChem CID 142549073) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile.
Analyze ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile?
The IUPAC name of ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile (CID 142549073) is ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile.
What is the SMILES notation for ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile?
The canonical SMILES for ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile is CC.N#CC1CCCC2=C1N=CCC2.
What is the InChIKey of ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile?
The InChIKey is BPTAJQJKWOCZIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C2H6/c11-7-9-4-1-3-8-5-2-6-12-10(8)9;1-2/h6,9H,1-5H2;1-2H3.
What are the key properties of ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile?
ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile has a molecular weight of 190.29 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,4,5,6,7,8-hexahydroquinoline-8-carbonitrile is sourced from PubChem (CID 142549073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).