C21H23ClN2O8 — CID 142550517
[(Z)-(1-amino-2-hydroxy-2-methylpropylidene)amino] (2S,5'R)-7-chloro-1',4-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate (PubChem CID 142550517) has the molecular formula C21H23ClN2O8 and a molecular weight of 466.87 g/mol. Its IUPAC name is [(Z)-(1-amino-2-hydroxy-2-methylpropylidene)amino] (2S,5'R)-7-chloro-1',4-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate.
| Compound Name | [(Z)-(1-amino-2-hydroxy-2-methylpropylidene)amino] (2S,5'R)-7-chloro-1',4-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate |
|---|---|
| PubChem CID | 142550517 |
| Molecular Formula | C21H23ClN2O8 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | [(Z)-(1-amino-2-hydroxy-2-methylpropylidene)amino] (2S,5'R)-7-chloro-1',4-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carboxylate |
| SMILES | COC1=CC(=O)C[C@@H](C)[C@]12Oc1c(Cl)c(C(=O)O/N=C(\N)C(C)(C)O)cc(OC)c1C2=O |
| InChI | InChI=1S/C21H23ClN2O8/c1-9-6-10(25)7-13(30-5)21(9)17(26)14-12(29-4)8-11(15(22)16(14)31-21)18(27)32-24-19(23)20(2,3)28/h7-9,28H,6H2,1-5H3,(H2,23,24)/t9-,21+/m1/s1 |
| InChIKey | DCNFNLJRLQCEMD-BTKVJGODSA-N |
| XLogP | 2.00 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|